EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H12I3N3O5 |
| Net Charge | 0 |
| Average Mass | 670.967 |
| Monoisotopic Mass | 670.79111 |
| SMILES | CNC(=O)CNC(=O)c1c(I)c(NC(C)=O)c(I)c(C(=O)O)c1I |
| InChI | InChI=1S/C13H12I3N3O5/c1-4(20)19-11-9(15)6(12(22)18-3-5(21)17-2)8(14)7(10(11)16)13(23)24/h3H2,1-2H3,(H,17,21)(H,18,22)(H,19,20)(H,23,24) |
| InChIKey | HHFIATHHSBFCBY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ioglicic acid (CHEBI:135999) is a amidobenzoic acid (CHEBI:48470) |
| INNs | Source |
|---|---|
| acide ioglicique | WHO MedNet |
| acido ioglicico | WHO MedNet |
| Synonyms | Source |
|---|---|
| Ioglicic acid | ChEMBL |
| ioglicinate | DrugCentral |
| SH H 200 AB | ChEMBL |
| SH-H-200-AB | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 4580 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:49755-67-1 | DrugCentral |