EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H10N3 |
| Net Charge | 0 |
| Average Mass | 279.095 |
| Monoisotopic Mass | 278.99360 |
| SMILES | N=C(N)NCc1cccc([131I])c1 |
| InChI | InChI=1S/C8H10IN3/c9-7-3-1-2-6(4-7)5-12-8(10)11/h1-4H,5H2,(H4,10,11,12)/i9+4 |
| InChIKey | PDWUPXJEEYOOTR-JRGAVVOBSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| iobenguane (131I) (CHEBI:135997) has role antineoplastic agent (CHEBI:35610) |
| iobenguane (131I) (CHEBI:135997) is a organoiodine compound (CHEBI:37142) |
| INN | Source |
|---|---|
| iobenguano (131i) | WHO MedNet |
| Synonyms | Source |
|---|---|
| (131i)-mibg | ChEMBL |
| 131 i-mibg | ChEMBL |
| 131i-mibg | ChEMBL |
| 3-iodobenzylguanidine (131i) | ChEMBL |
| 3-iodobenzylguanidine, i-131 | ChEMBL |
| I-131 metaiodobenzylguanidine | ChEMBL |
| Brand Names | Source |
|---|---|
| Azedra | ChEMBL |
| Ultratrace iodine i 131 metaiodobenzylguanidine | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 4577 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:77679-27-7 | DrugCentral |