EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H12IN3O4 |
| Net Charge | 0 |
| Average Mass | 353.116 |
| Monoisotopic Mass | 352.98725 |
| SMILES | Nc1nc(=O)n([C@H]2C[C@H](O)[C@@H](CO)O2)cc1I |
| InChI | InChI=1S/C9H12IN3O4/c10-4-2-13(9(16)12-8(4)11)7-1-5(15)6(3-14)17-7/h2,5-7,14-15H,1,3H2,(H2,11,12,16)/t5-,6+,7+/m0/s1 |
| InChIKey | WEVJJMPVVFNAHZ-RRKCRQDMSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ibacitabine (CHEBI:135996) has role antiviral agent (CHEBI:22587) |
| ibacitabine (CHEBI:135996) is a pyrimidine 2'-deoxyribonucleoside (CHEBI:19255) |
| INN | Source |
|---|---|
| ibacitabina | WHO MedNet |
| Synonyms | Source |
|---|---|
| Ibacitabine | ChEMBL |
| iododeoxycytidine | DrugCentral |
| NSC-527083 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 4572 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:611-53-0 | DrugCentral |
| Citations |
|---|