EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26N2O2 |
| Net Charge | 0 |
| Average Mass | 326.440 |
| Monoisotopic Mass | 326.19943 |
| SMILES | [H][C@@]1([C@H](O)c2ccnc3ccc(OC)cc23)C[C@@H]2CC[N@@]1C[C@@H]2CC |
| InChI | InChI=1S/C20H26N2O2/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18/h4-6,8,11,13-14,19-20,23H,3,7,9-10,12H2,1-2H3/t13-,14-,19-,20+/m0/s1 |
| InChIKey | LJOQGZACKSYWCH-WZBLMQSHSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hydroquinine (CHEBI:135994) is a cinchona alkaloid (CHEBI:51323) |
| Synonym | Source |
|---|---|
| dihydroquinine | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 4570 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:522-66-7 | DrugCentral |