EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H12Cl2N4O |
| Net Charge | 0 |
| Average Mass | 263.128 |
| Monoisotopic Mass | 262.03882 |
| SMILES | N=C(N)NNCCOc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C9H12Cl2N4O/c10-6-2-1-3-7(11)8(6)16-5-4-14-15-9(12)13/h1-3,14H,4-5H2,(H4,12,13,15) |
| InChIKey | XIHXRRMCNSMUET-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| guanoclor (CHEBI:135992) has role antihypertensive agent (CHEBI:35674) |
| guanoclor (CHEBI:135992) is a dichlorobenzene (CHEBI:23697) |
| INN | Source |
|---|---|
| guanocloro | WHO MedNet |
| Synonyms | Source |
|---|---|
| Guanochlor | ChEMBL |
| guanochlorine | DrugCentral |
| Guanoclor | ChEMBL |
| NSC-108163 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 4564 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:5001-32-1 | DrugCentral |