EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H18As2N2O6 |
| Net Charge | 0 |
| Average Mass | 460.150 |
| Monoisotopic Mass | 459.95968 |
| SMILES | O=[As](O)(O)c1ccc(NCCNc2ccc([As](=O)(O)O)cc2)cc1 |
| InChI | InChI=1S/C14H18As2N2O6/c19-15(20,21)11-1-5-13(6-2-11)17-9-10-18-14-7-3-12(4-8-14)16(22,23)24/h1-8,17-18H,9-10H2,(H2,19,20,21)(H2,22,23,24) |
| InChIKey | YQVALJGIKVYRNI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antiamoebic agent An antiparasitic agent which is effective against amoeba, a genus of single-celled amoeboids in the family Amoebidae. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| difetarsone (CHEBI:135969) has role antiamoebic agent (CHEBI:171664) |
| difetarsone (CHEBI:135969) is a aralkylamine (CHEBI:18000) |
| INN | Source |
|---|---|
| difetarsona | WHO MedNet |
| Synonyms | Source |
|---|---|
| Anhydrous difetarsone sodium | ChEMBL |
| Bemarsal | ChEMBL |
| Difetarsone | ChEMBL |
| Difetarsone sodium | ChEMBL |
| Difetarsone sodium anhydrous | ChEMBL |
| diphetarsone | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 4419 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:3639-19-8 | DrugCentral |
| Citations |
|---|