EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H26N8O11S2 |
| Net Charge | 0 |
| Average Mass | 690.673 |
| Monoisotopic Mass | 690.11625 |
| SMILES | [H][C@@]1(N2CC/C(=C\C3=C(C(=O)O)N4C(=O)[C@@]([H])(NC(=O)/C(=N\O)c5nsc(N)n5)[C@@]4([H])SC3)C2=O)CCN(C(=O)OCc2oc(=O)oc2C)C1 |
| InChI | InChI=1S/C26H26N8O11S2/c1-10-14(45-26(41)44-10)8-43-25(40)32-4-3-13(7-32)33-5-2-11(20(33)36)6-12-9-46-22-16(21(37)34(22)17(12)23(38)39)28-19(35)15(30-42)18-29-24(27)47-31-18/h6,13,16,22,42H,2-5,7-9H2,1H3,(H,28,35)(H,38,39)(H2,27,29,31)/b11-6+,30-15-/t13-,16-,22-/m1/s1 |
| InChIKey | HFTSMHTWUFCYMJ-YIOMYIDASA-N |
| Roles Classification |
|---|
| Biological Roles: | drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ceftobiprole medocaril (CHEBI:135968) has role prodrug (CHEBI:50266) |
| ceftobiprole medocaril (CHEBI:135968) is a cephalosporin (CHEBI:23066) |
| Synonyms | Source |
|---|---|
| BAL5788 | DrugCentral |
| BAL 9141 | DrugCentral |
| BAL-9141 | DrugCentral |
| BAL9141 | DrugCentral |
| BAL 9141-000 | DrugCentral |
| ceftobiprole medocaril sodium | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 4402 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:376653-43-9 | DrugCentral |