EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H35F7N4O2 |
| Net Charge | 0 |
| Average Mass | 616.622 |
| Monoisotopic Mass | 616.26482 |
| SMILES | CC(=O)N1CCN([C@H]2CCN(C(=O)N(C)[C@H](C)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)[C@@H](c3ccc(F)cc3C)C2)CC1 |
| InChI | InChI=1S/C30H35F7N4O2/c1-18-13-24(31)5-6-26(18)27-17-25(40-11-9-39(10-12-40)20(3)42)7-8-41(27)28(43)38(4)19(2)21-14-22(29(32,33)34)16-23(15-21)30(35,36)37/h5-6,13-16,19,25,27H,7-12,17H2,1-4H3/t19-,25+,27-/m1/s1 |
| InChIKey | XGGTZCKQRWXCHW-WMTVXVAQSA-N |
| Roles Classification |
|---|
| Applications: | antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| casopitant (CHEBI:135967) has role antidepressant (CHEBI:35469) |
| casopitant (CHEBI:135967) has role antiemetic (CHEBI:50919) |
| casopitant (CHEBI:135967) is a piperidines (CHEBI:26151) |
| Synonyms | Source |
|---|---|
| Casopitant | ChEMBL |
| casopitant mesilate | DrugCentral |
| casopitant mesylate | DrugCentral |
| GW-679769 | DrugCentral |
| GW679769 | DrugCentral |
| zunrisa | DrugCentral |
| Brand Name | Source |
|---|---|
| Rezonic | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 4401 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:414910-27-3 | DrugCentral |
| Citations |
|---|