EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13FN2O5 |
| Net Charge | 0 |
| Average Mass | 260.221 |
| Monoisotopic Mass | 260.08085 |
| SMILES | Cc1cn([C@H]2O[C@@H](CO)[C@H](O)[C@H]2F)c(=O)nc1=O |
| InChI | InChI=1S/C10H13FN2O5/c1-4-2-13(10(17)12-8(4)16)9-6(11)7(15)5(3-14)18-9/h2,5-7,9,14-15H,3H2,1H3,(H,12,16,17)/t5-,6+,7-,9-/m0/s1 |
| InChIKey | GBBJCSTXCAQSSJ-XQXXSGGOSA-N |
| Roles Classification |
|---|
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. anti-HBV agent An antiviral agent that destroys or inhibits the replication of the hepatitis B virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clevudine (CHEBI:135964) has role anti-HBV agent (CHEBI:64951) |
| clevudine (CHEBI:135964) has role antiviral agent (CHEBI:22587) |
| clevudine (CHEBI:135964) is a pyrimidine 2'-deoxyribonucleoside (CHEBI:19255) |
| INN | Source |
|---|---|
| clevudina | WHO MedNet |
| Synonyms | Source |
|---|---|
| Clevudine | ChEMBL |
| levovir | DrugCentral |
| L-FMAU | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 4394 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:163252-36-6 | DrugCentral |
| Citations |
|---|