EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H16Cl2N2O5 |
| Net Charge | 0 |
| Average Mass | 399.230 |
| Monoisotopic Mass | 398.04363 |
| SMILES | O=C(C(Cl)Cl)N(CCO)Cc1ccc(Oc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C17H16Cl2N2O5/c18-16(19)17(23)20(9-10-22)11-12-1-5-14(6-2-12)26-15-7-3-13(4-8-15)21(24)25/h1-8,16,22H,9-11H2 |
| InChIKey | ODCUSWJXZDHLKV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antiamoebic agent An antiparasitic agent which is effective against amoeba, a genus of single-celled amoeboids in the family Amoebidae. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clefamide (CHEBI:135963) has role antiamoebic agent (CHEBI:171664) |
| clefamide (CHEBI:135963) is a aromatic ether (CHEBI:35618) |
| INN | Source |
|---|---|
| clefamida | WHO MedNet |
| Synonyms | Source |
|---|---|
| chlorophenoxamide | DrugCentral |
| chlorphenoxamide | DrugCentral |
| Clefamide | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 4393 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:3576-64-5 | DrugCentral |