EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H31NO4 |
| Net Charge | 0 |
| Average Mass | 349.471 |
| Monoisotopic Mass | 349.22531 |
| SMILES | COc1ccc(CCO[C@@H]2CCCC[C@H]2N2CC[C@@H](O)C2)cc1OC |
| InChI | InChI=1S/C20H31NO4/c1-23-19-8-7-15(13-20(19)24-2)10-12-25-18-6-4-3-5-17(18)21-11-9-16(22)14-21/h7-8,13,16-18,22H,3-6,9-12,14H2,1-2H3/t16-,17-,18-/m1/s1 |
| InChIKey | VBHQKCBVWWUUKN-KZNAEPCWSA-N |
| Roles Classification |
|---|
| Application: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vernakalant (CHEBI:135956) has role anti-arrhythmia drug (CHEBI:38070) |
| vernakalant (CHEBI:135956) is a alcohol (CHEBI:30879) |
| vernakalant (CHEBI:135956) is a phenols (CHEBI:33853) |
| Synonyms | Source |
|---|---|
| brinavess | DrugCentral |
| RSD1235 | DrugCentral |
| Vernakalant | ChEMBL |
| vernakalant HCl | DrugCentral |
| vernakalant hydrochloride | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 4365 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:794466-70-9 | DrugCentral |
| Citations |
|---|