EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H37N3O3 |
| Net Charge | 0 |
| Average Mass | 463.622 |
| Monoisotopic Mass | 463.28349 |
| SMILES | CCOCCn1c(C2CCN(CCc3ccc(C(C)(C)C(=O)O)cc3)CC2)nc2ccccc21 |
| InChI | InChI=1S/C28H37N3O3/c1-4-34-20-19-31-25-8-6-5-7-24(25)29-26(31)22-14-17-30(18-15-22)16-13-21-9-11-23(12-10-21)28(2,3)27(32)33/h5-12,22H,4,13-20H2,1-3H3,(H,32,33) |
| InChIKey | ACCMWZWAEFYUGZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. anti-allergic agent A drug used to treat allergic reactions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bilastine (CHEBI:135954) has role anti-allergic agent (CHEBI:50857) |
| bilastine (CHEBI:135954) has role ophthalmology drug (CHEBI:66981) |
| bilastine (CHEBI:135954) is a benzimidazoles (CHEBI:22715) |
| INN | Source |
|---|---|
| bilastina | WHO MedNet |
| Synonyms | Source |
|---|---|
| bellozal | DrugCentral |
| Bilastine | ChEMBL |
| bilaxten | DrugCentral |
| F-96221-BM1 | DrugCentral |
| Brand Name | Source |
|---|---|
| Ilaxten | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 4353 | DrugCentral |
| HMDB0240232 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:202189-78-4 | DrugCentral |