EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6HBiBr4O3 |
| Net Charge | 0 |
| Average Mass | 649.667 |
| Monoisotopic Mass | 645.64632 |
| SMILES | [OH][Bi]1[O]c2c(Br)c(Br)c(Br)c(Br)c2[O]1 |
| InChI | InChI=1S/C6H2Br4O2.Bi.H2O/c7-1-2(8)4(10)6(12)5(11)3(1)9;;/h11-12H;;1H2/q;+3;/p-3 |
| InChIKey | VTAVFIZOZUAKKE-UHFFFAOYSA-K |
| Roles Classification |
|---|
| Application: | ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bibrocathol (CHEBI:135953) has role ophthalmology drug (CHEBI:66981) |
| bibrocathol (CHEBI:135953) is a organobromine compound (CHEBI:37141) |
| INN | Source |
|---|---|
| bibrocatol | WHO MedNet |
| Synonyms | Source |
|---|---|
| bibrocathin | DrugCentral |
| Bibrocathol | ChEMBL |
| bismucatebrol | DrugCentral |
| Noviform | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 4352 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:6915-57-7 | DrugCentral |
| Citations |
|---|