EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:135948 - amifampridine
| Formula | C5H7N3 |
| Net Charge | 0 |
| Average Mass | 109.132 |
| Monoisotopic Mass | 109.06400 |
| SMILES | Nc1ccncc1N |
| InChI | InChI=1S/C5H7N3/c6-4-1-2-8-3-5(4)7/h1-3H,7H2,(H2,6,8) |
| InChIKey | OYTKINVCDFNREN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. |
| Application: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amifampridine (CHEBI:135948) has role immunosuppressive agent (CHEBI:35705) |
| amifampridine (CHEBI:135948) is a aminopyridine (CHEBI:38207) |
| amifampridine (CHEBI:135948) is a chloropyridine (CHEBI:39173) |
| amifampridine (CHEBI:135948) is a organic molecular entity (CHEBI:50860) |
| INN | Source |
|---|---|
| amifampridina | WHO MedNet |
| Synonyms | Source |
|---|---|
| 3,4-DAP | DrugCentral |
| 3,4-diammoniopyridinium | ChEMBL |
| 4-DAP | ChEMBL |
| amifampridin | DrugCentral |
| Amifampridine | ChEMBL |
| amifampridine phosphate | DrugCentral |
| Brand Name | Source |
|---|---|
| Ruzurgi | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 4336 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:54-96-6 | DrugCentral |
| Citations |
|---|