EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H34N2O3 |
| Net Charge | 0 |
| Average Mass | 470.613 |
| Monoisotopic Mass | 470.25694 |
| SMILES | Cc1c(-c2ccc(O)cc2)n(Cc2ccc(OCCN3CCCCCC3)cc2)c2ccc(O)cc12 |
| InChI | InChI=1S/C30H34N2O3/c1-22-28-20-26(34)12-15-29(28)32(30(22)24-8-10-25(33)11-9-24)21-23-6-13-27(14-7-23)35-19-18-31-16-4-2-3-5-17-31/h6-15,20,33-34H,2-5,16-19,21H2,1H3 |
| InChIKey | UCJGJABZCDBEDK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bazedoxifene (CHEBI:135947) has role antineoplastic agent (CHEBI:35610) |
| bazedoxifene (CHEBI:135947) has role bone density conservation agent (CHEBI:50646) |
| bazedoxifene (CHEBI:135947) is a indoles (CHEBI:24828) |
| bazedoxifene (CHEBI:135947) is a organic molecular entity (CHEBI:50860) |
| bazedoxifene (CHEBI:135947) is a phenylindole (CHEBI:48559) |
| INN | Source |
|---|---|
| bazedoxifeno | WHO MedNet |
| Synonyms | Source |
|---|---|
| Bazedoxifene | ChEMBL |
| bazedoxifene acetate | DrugCentral |
| conbriza | DrugCentral |
| TSE-424 | DrugCentral |
| TSE424 | DrugCentral |
| Brand Names | Source |
|---|---|
| Bazedoxifene component of ak r215 | ChEMBL |
| Bazedoxifene component of ak-r215 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 4334 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:198481-32-2 | DrugCentral |
| Citations |
|---|