EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H19N5O2 |
| Net Charge | 0 |
| Average Mass | 325.372 |
| Monoisotopic Mass | 325.15387 |
| SMILES | NCCNc1ccc(NCCN)c2c1C(=O)c1ccncc1C2=O |
| InChI | InChI=1S/C17H19N5O2/c18-4-7-21-12-1-2-13(22-8-5-19)15-14(12)16(23)10-3-6-20-9-11(10)17(15)24/h1-3,6,9,21-22H,4-5,7-8,18-19H2 |
| InChIKey | PEZPMAYDXJQYRV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pixantrone (CHEBI:135945) has role antineoplastic agent (CHEBI:35610) |
| pixantrone (CHEBI:135945) is a isoquinolines (CHEBI:24922) |
| INN | Source |
|---|---|
| pixantrona | WHO MedNet |
| Synonyms | Source |
|---|---|
| BBR 2778 | ChEMBL |
| BBR-2778 | ChEMBL |
| BBR2778 | ChEMBL |
| Pixantrone | ChEMBL |
| pixantrone dimaleate | DrugCentral |
| pixantrone maleate | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 4330 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:144675-97-8 | DrugCentral |
| Citations |
|---|