EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H19ClFNO4S |
| Net Charge | 0 |
| Average Mass | 435.904 |
| Monoisotopic Mass | 435.07073 |
| SMILES | CS(=O)(=O)c1cc(F)cc2c3c(n(Cc4ccc(Cl)cc4)c12)[C@@H](CC(=O)O)CC3 |
| InChI | InChI=1S/C21H19ClFNO4S/c1-29(27,28)18-10-15(23)9-17-16-7-4-13(8-19(25)26)20(16)24(21(17)18)11-12-2-5-14(22)6-3-12/h2-3,5-6,9-10,13H,4,7-8,11H2,1H3,(H,25,26)/t13-/m1/s1 |
| InChIKey | NXFFJDQHYLNEJK-CYBMUJFWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| laropiprant (CHEBI:135942) is a indolyl carboxylic acid (CHEBI:46867) |
| Synonyms | Source |
|---|---|
| MK 0524 | DrugCentral |
| MK-0524 | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 4326 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:571170-77-9 | DrugCentral |