EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H18N2O3 |
| Net Charge | 0 |
| Average Mass | 250.298 |
| Monoisotopic Mass | 250.13174 |
| SMILES | COC[C@@H](NC(C)=O)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C13H18N2O3/c1-10(16)15-12(9-18-2)13(17)14-8-11-6-4-3-5-7-11/h3-7,12H,8-9H2,1-2H3,(H,14,17)(H,15,16)/t12-/m1/s1 |
| InChIKey | VPPJLAIAVCUEMN-GFCCVEGCSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lacosamide (CHEBI:135939) is a N-acyl-amino acid (CHEBI:51569) |
| Synonyms | Source |
|---|---|
| erlosamide | DrugCentral |
| ertosamide | DrugCentral |
| harkoseride | DrugCentral |
| SPM-927 | DrugCentral |
| vimpat | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 4310 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:175481-36-4 | DrugCentral |