EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H31NO2 |
| Net Charge | 0 |
| Average Mass | 413.561 |
| Monoisotopic Mass | 413.23548 |
| SMILES | [H][C@@]1(c2ccc(OCCN3CCCC3)cc2)c2ccc(O)cc2CC[C@]1([H])c1ccccc1 |
| InChI | InChI=1S/C28H31NO2/c30-24-11-15-27-23(20-24)10-14-26(21-6-2-1-3-7-21)28(27)22-8-12-25(13-9-22)31-19-18-29-16-4-5-17-29/h1-3,6-9,11-13,15,20,26,28,30H,4-5,10,14,16-19H2/t26-,28+/m1/s1 |
| InChIKey | GXESHMAMLJKROZ-IAPPQJPRSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | estrogen receptor antagonist An antagonist at the estrogen receptor. estrogen receptor agonist An agonist at the estrogen receptor. |
| Applications: | estrogen receptor antagonist An antagonist at the estrogen receptor. cardioprotective agent Any protective agent that is able to prevent damage to the heart. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lasofoxifene (CHEBI:135938) has role antineoplastic agent (CHEBI:35610) |
| lasofoxifene (CHEBI:135938) has role bone density conservation agent (CHEBI:50646) |
| lasofoxifene (CHEBI:135938) has role cardioprotective agent (CHEBI:77307) |
| lasofoxifene (CHEBI:135938) has role estrogen receptor agonist (CHEBI:63951) |
| lasofoxifene (CHEBI:135938) has role estrogen receptor antagonist (CHEBI:50792) |
| lasofoxifene (CHEBI:135938) is a N-alkylpyrrolidine (CHEBI:46775) |
| lasofoxifene (CHEBI:135938) is a aromatic ether (CHEBI:35618) |
| lasofoxifene (CHEBI:135938) is a naphthols (CHEBI:25392) |
| lasofoxifene (CHEBI:135938) is a tetralins (CHEBI:36786) |
| IUPAC Name |
|---|
| (5R,6S)-6-phenyl-5-{4-[2-(pyrrolidin-1-yl)ethoxy]phenyl}-5,6,7,8-tetrahydronaphthalen-2-ol |
| INNs | Source |
|---|---|
| lasofoxifene | WHO MedNet |
| lasofoxiféne | WHO MedNet |
| lasofoxifeno | WHO MedNet |
| lasofoxifenum | WHO MedNet |
| Synonyms | Source |
|---|---|
| CP 336156 | ChemIDplus |
| CP-336,156 | ChemIDplus |
| CP-336156 | DrugCentral |
| (−)-cis-5,6,7,8-tetrahydro-6-phenyl-5-(p-(2-(1-pyrrolidinyl)ethoxy)phenyl)-2-naphthol | ChemIDplus |
| (−)-cis-(5R,6S)-6-phenyl-5-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-5,6,7,8-tetrahydronaphthalen-2-ol | ChEBI |
| Brand Name | Source |
|---|---|
| Oporia | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 4308 | DrugCentral |
| C3D | PDBeChem |
| DB06202 | DrugBank |
| Lasofoxifene | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:180916-16-9 | ChemIDplus |
| Citations |
|---|