EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H31NO2 |
| Net Charge | 0 |
| Average Mass | 413.561 |
| Monoisotopic Mass | 413.23548 |
| SMILES | [H][C@@]1(c2ccc(OCCN3CCCC3)cc2)c2ccc(O)cc2CC[C@]1([H])c1ccccc1 |
| InChI | InChI=1S/C28H31NO2/c30-24-11-15-27-23(20-24)10-14-26(21-6-2-1-3-7-21)28(27)22-8-12-25(13-9-22)31-19-18-29-16-4-5-17-29/h1-3,6-9,11-13,15,20,26,28,30H,4-5,10,14,16-19H2/t26-,28+/m1/s1 |
| InChIKey | GXESHMAMLJKROZ-IAPPQJPRSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | estrogen receptor agonist An agonist at the estrogen receptor. estrogen receptor antagonist An antagonist at the estrogen receptor. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. cardioprotective agent Any protective agent that is able to prevent damage to the heart. bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. estrogen receptor antagonist An antagonist at the estrogen receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lasofoxifene (CHEBI:135938) has role antineoplastic agent (CHEBI:35610) |
| lasofoxifene (CHEBI:135938) has role bone density conservation agent (CHEBI:50646) |
| lasofoxifene (CHEBI:135938) has role cardioprotective agent (CHEBI:77307) |
| lasofoxifene (CHEBI:135938) has role estrogen receptor agonist (CHEBI:63951) |
| lasofoxifene (CHEBI:135938) has role estrogen receptor antagonist (CHEBI:50792) |
| lasofoxifene (CHEBI:135938) is a N-alkylpyrrolidine (CHEBI:46775) |
| lasofoxifene (CHEBI:135938) is a aromatic ether (CHEBI:35618) |
| lasofoxifene (CHEBI:135938) is a naphthols (CHEBI:25392) |
| lasofoxifene (CHEBI:135938) is a tetralins (CHEBI:36786) |
| IUPAC Name |
|---|
| (5R,6S)-6-phenyl-5-{4-[2-(pyrrolidin-1-yl)ethoxy]phenyl}-5,6,7,8-tetrahydronaphthalen-2-ol |
| INNs | Source |
|---|---|
| lasofoxifene | WHO MedNet |
| lasofoxiféne | WHO MedNet |
| lasofoxifeno | WHO MedNet |
| lasofoxifenum | WHO MedNet |
| Synonyms | Source |
|---|---|
| CP 336156 | ChemIDplus |
| CP-336,156 | ChemIDplus |
| CP-336156 | DrugCentral |
| (−)-cis-5,6,7,8-tetrahydro-6-phenyl-5-(p-(2-(1-pyrrolidinyl)ethoxy)phenyl)-2-naphthol | ChemIDplus |
| (−)-cis-(5R,6S)-6-phenyl-5-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-5,6,7,8-tetrahydronaphthalen-2-ol | ChEBI |
| Brand Name | Source |
|---|---|
| Oporia | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 4308 | DrugCentral |
| C3D | PDBeChem |
| DB06202 | DrugBank |
| Lasofoxifene | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:180916-16-9 | ChemIDplus |
| Citations |
|---|