EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:135932 - Padimate O
| Formula | C17H27NO2 |
| Net Charge | 0 |
| Average Mass | 277.408 |
| Monoisotopic Mass | 277.20418 |
| SMILES | CCCCC(CC)COC(=O)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C17H27NO2/c1-5-7-8-14(6-2)13-20-17(19)15-9-11-16(12-10-15)18(3)4/h9-12,14H,5-8,13H2,1-4H3 |
| InChIKey | WYWZRNAHINYAEF-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Padimate O (CHEBI:135932) is a benzoate ester (CHEBI:36054) |
| Synonyms | Source |
|---|---|
| 4-(dimethylamino)benzoic acid 2-ethylhexyl ester | ChEMBL |
| Ethylhexyl dimethyl paba | ChEMBL |
| Eusolex 6007 | ChEMBL |
| Octyl dimethyl PABA | DrugCentral |
| Padimate o | ChEMBL |
| Padimate-o | ChEMBL |
| Brand Names | Source |
|---|---|
| Arlatone uvb | ChEMBL |
| Escalol 507 | ChEMBL |
| Spectraban 25 | ChEMBL |
| Spectraban 4 | ChEMBL |
| Spectraban ultra | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 4270 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:21245-02-3 | DrugCentral |