EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H41N3O6 |
| Net Charge | 0 |
| Average Mass | 611.739 |
| Monoisotopic Mass | 611.29954 |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OC(C)(C)CN(C)CCC(c2ccccc2)c2ccccc2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C36H41N3O6/c1-24-31(34(40)44-6)33(28-18-13-19-29(22-28)39(42)43)32(25(2)37-24)35(41)45-36(3,4)23-38(5)21-20-30(26-14-9-7-10-15-26)27-16-11-8-12-17-27/h7-19,22,30,33,37H,20-21,23H2,1-6H3 |
| InChIKey | ZDXUKAKRHYTAKV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lercanidipine (CHEBI:135930) has role antihypertensive agent (CHEBI:35674) |
| lercanidipine (CHEBI:135930) has role cardiovascular drug (CHEBI:35554) |
| lercanidipine (CHEBI:135930) is a diarylmethane (CHEBI:51614) |
| INN | Source |
|---|---|
| lercanidipino | WHO MedNet |
| Synonyms | Source |
|---|---|
| Lercanidipine | ChEMBL |
| lercanidipine HCl | DrugCentral |
| lercanidipine hydrochloride | DrugCentral |
| Lercanil | ChEMBL |
| masnidipine | DrugCentral |
| zanidip | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 4157 | DrugCentral |
| HMDB0014669 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:100427-26-7 | DrugCentral |
| Citations |
|---|