EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H32F3N3O4 |
| Net Charge | 0 |
| Average Mass | 495.542 |
| Monoisotopic Mass | 495.23449 |
| SMILES | C[C@H](Cc1cc2c(c(C(N)=O)c1)N(CCCO)CC2)NCCOc1ccccc1OCC(F)(F)F |
| InChI | InChI=1S/C25H32F3N3O4/c1-17(30-8-12-34-21-5-2-3-6-22(21)35-16-25(26,27)28)13-18-14-19-7-10-31(9-4-11-32)23(19)20(15-18)24(29)33/h2-3,5-6,14-15,17,30,32H,4,7-13,16H2,1H3,(H2,29,33)/t17-/m1/s1 |
| InChIKey | PNCPYILNMDWPEY-QGZVFWFLSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| silodosin (CHEBI:135929) has role antineoplastic agent (CHEBI:35610) |
| silodosin (CHEBI:135929) is a indolecarboxamide (CHEBI:46921) |
| INNs | Source |
|---|---|
| silodosina | WHO MedNet |
| silodosine | WHO MedNet |
| Synonyms | Source |
|---|---|
| KAD-3213 | ChEMBL |
| KMD-3213 | ChEMBL |
| Kso-0400 | ChEMBL |
| rapaflo | DrugCentral |
| Rapilif | ChEMBL |
| Silodal | ChEMBL |
| Brand Name | Source |
|---|---|
| Silodosin recordati | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 4151 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:160970-54-7 | DrugCentral |
| Citations |
|---|