EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24N4O6S2 |
| Net Charge | 0 |
| Average Mass | 420.513 |
| Monoisotopic Mass | 420.11373 |
| SMILES | C[C@@H](O)[C@H]1C(=O)N2C(C(=O)O)=C(S[C@@H]3CN[C@H](CNS(N)(=O)=O)C3)[C@H](C)[C@H]12 |
| InChI | InChI=1S/C15H24N4O6S2/c1-6-11-10(7(2)20)14(21)19(11)12(15(22)23)13(6)26-9-3-8(17-5-9)4-18-27(16,24)25/h6-11,17-18,20H,3-5H2,1-2H3,(H,22,23)(H2,16,24,25)/t6-,7-,8+,9+,10-,11-/m1/s1 |
| InChIKey | AVAACINZEOAHHE-VFZPANTDSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| doripenem (CHEBI:135928) is a carbapenems (CHEBI:46633) |
| Synonyms | Source |
|---|---|
| doribax | DrugCentral |
| doripenem hydrate | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 4149 | DrugCentral |
| HMDB0041883 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:148016-81-3 | DrugCentral |