EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:135924 - amfecloral
| Formula | C11H12Cl3N |
| Net Charge | 0 |
| Average Mass | 264.583 |
| Monoisotopic Mass | 263.00353 |
| SMILES | CC(Cc1ccccc1)/N=C/C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H12Cl3N/c1-9(15-8-11(12,13)14)7-10-5-3-2-4-6-10/h2-6,8-9H,7H2,1H3/b15-8+ |
| InChIKey | VBZDETYCYXPOAK-OVCLIPMQSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amfecloral (CHEBI:135924) is a amphetamines (CHEBI:35338) |
| Synonyms | Source |
|---|---|
| acutran | DrugCentral |
| amphecloral | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 5113 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:5581-35-1 | DrugCentral |