EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H19FN4O2 |
| Net Charge | 0 |
| Average Mass | 390.418 |
| Monoisotopic Mass | 390.14920 |
| SMILES | Nc1cc(F)ccc1NC(=O)c1ccc(CNC(=O)/C=C/c2cccnc2)cc1 |
| InChI | InChI=1S/C22H19FN4O2/c23-18-8-9-20(19(24)12-18)27-22(29)17-6-3-16(4-7-17)14-26-21(28)10-5-15-2-1-11-25-13-15/h1-13H,14,24H2,(H,26,28)(H,27,29)/b10-5+ |
| InChIKey | SZMJVTADHFNAIS-BJMVGYQFSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chidamide (CHEBI:135918) has role anti-HIV agent (CHEBI:64946) |
| chidamide (CHEBI:135918) has role antineoplastic agent (CHEBI:35610) |
| chidamide (CHEBI:135918) is a benzamides (CHEBI:22702) |
| Synonyms | Source |
|---|---|
| C5055 | DrugCentral |
| Chidamide | ChEMBL |
| CS-055 | DrugCentral |
| CS055 | ChEMBL |
| epidaza | DrugCentral |
| HBI-8000 | DrugCentral |
| Brand Name | Source |
|---|---|
| Epidaza in china | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 4973 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:743420-02-2 | DrugCentral |
| Citations |
|---|