EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C60H86N16O13 |
| Net Charge | 0 |
| Average Mass | 1239.447 |
| Monoisotopic Mass | 1238.65603 |
| SMILES | CCNC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](COC(C)(C)C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CO)NC(=O)[C@H](Cc1cnc2ccccc12)NC(=O)[C@H](Cc1cncn1)NC(=O)[C@@H]1CCC(=O)N1 |
| InChI | InChI=1S/C60H86N16O13/c1-7-64-57(87)48-15-11-23-76(48)58(88)41(14-10-22-65-59(61)62)69-51(81)42(24-33(2)3)70-56(86)47(31-89-60(4,5)6)75-52(82)43(25-34-16-18-37(78)19-17-34)71-55(85)46(30-77)74-53(83)44(26-35-28-66-39-13-9-8-12-38(35)39)72-54(84)45(27-36-29-63-32-67-36)73-50(80)40-20-21-49(79)68-40/h8-9,12-13,16-19,28-29,32-33,40-48,66,77-78H,7,10-11,14-15,20-27,30-31H2,1-6H3,(H,63,67)(H,64,87)(H,68,79)(H,69,81)(H,70,86)(H,71,85)(H,72,84)(H,73,80)(H,74,83)(H,75,82)(H4,61,62,65)/t40-,41-,42-,43-,44-,45-,46-,47+,48-/m0/s1 |
| InChIKey | CUWODFFVMXJOKD-UVLQAERKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| buserelin (CHEBI:135907) has role antineoplastic agent (CHEBI:35610) |
| buserelin (CHEBI:135907) is a oligopeptide (CHEBI:25676) |
| INNs | Source |
|---|---|
| buserelina | WHO MedNet |
| busereline | WHO MedNet |
| Synonyms | Source |
|---|---|
| Buserelin | ChEMBL |
| etilamide | DrugCentral |
| receptal | DrugCentral |
| Brand Names | Source |
|---|---|
| Suprecur | ChEMBL |
| Suprefact | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 436 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:57982-77-1 | DrugCentral |
| Citations |
|---|