EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28I3N3O9 |
| Net Charge | 0 |
| Average Mass | 835.168 |
| Monoisotopic Mass | 834.89597 |
| SMILES | COCC(O)CN(C(C)=O)c1c(I)c(C(=O)NCC(O)CO)c(I)c(C(=O)NCC(O)CO)c1I |
| InChI | InChI=1S/C20H28I3N3O9/c1-9(29)26(5-12(32)8-35-2)18-16(22)13(19(33)24-3-10(30)6-27)15(21)14(17(18)23)20(34)25-4-11(31)7-28/h10-12,27-28,30-32H,3-8H2,1-2H3,(H,24,33)(H,25,34) |
| InChIKey | IUNJANQVIJDFTQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| iopentol (CHEBI:135893) is a amidobenzoic acid (CHEBI:48470) |
| Synonyms | Source |
|---|---|
| CPD-5411 | ChEMBL |
| CPD. 5411 | ChEMBL |
| Iodixanol related compound d | ChEMBL |
| Iopentol | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1466 | DrugCentral |
| HMDB0041909 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:89797-00-2 | DrugCentral |