EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H68ClNO11 |
| Net Charge | 0 |
| Average Mass | 810.466 |
| Monoisotopic Mass | 809.44809 |
| SMILES | [H][C@@]12O[C@@](O)(C(=O)C(=O)N3CCCC[C@@]3([H])C(=O)O[C@H](/C(C)=C/[C@@H]3CC[C@H](Cl)[C@H](OC)C3)[C@H](C)[C@@H](O)CC(=O)[C@H](CC)/C=C(\C)C[C@H](C)C[C@@H]1OC)[C@H](C)C[C@@H]2OC |
| InChI | InChI=1S/C43H68ClNO11/c1-10-30-18-24(2)17-25(3)19-36(53-8)39-37(54-9)21-27(5)43(51,56-39)40(48)41(49)45-16-12-11-13-32(45)42(50)55-38(28(6)33(46)23-34(30)47)26(4)20-29-14-15-31(44)35(22-29)52-7/h18,20,25,27-33,35-39,46,51H,10-17,19,21-23H2,1-9H3/b24-18+,26-20+/t25-,27+,28+,29-,30+,31-,32-,33-,35+,36-,37-,38+,39+,43+/m0/s1 |
| InChIKey | KASDHRXLYQOAKZ-XDSKOBMDSA-N |
| Roles Classification |
|---|
| Applications: | dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pimecrolimus (CHEBI:135888) has role dermatologic drug (CHEBI:50177) |
| pimecrolimus (CHEBI:135888) has role ophthalmology drug (CHEBI:66981) |
| pimecrolimus (CHEBI:135888) is a lactam (CHEBI:24995) |
| pimecrolimus (CHEBI:135888) is a macrolide (CHEBI:25106) |
| Synonyms | Source |
|---|---|
| elidel | DrugCentral |
| picrolimus | DrugCentral |
| (-)-pimecrolimus | ChEMBL |
| Pimecrolimus | ChEMBL |
| SDZ ASM 981 | ChEMBL |
| SDZ ASM-981 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2168 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:137071-32-0 | DrugCentral |
| Citations |
|---|