EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H24I3N3O8 |
| Net Charge | 0 |
| Average Mass | 791.115 |
| Monoisotopic Mass | 790.86976 |
| SMILES | CC(=O)N(CC(O)CO)c1c(I)c(C(=O)NCCO)c(I)c(C(=O)NCC(O)CO)c1I |
| InChI | InChI=1S/C18H24I3N3O8/c1-8(28)24(5-10(30)7-27)16-14(20)11(17(31)22-2-3-25)13(19)12(15(16)21)18(32)23-4-9(29)6-26/h9-10,25-27,29-30H,2-7H2,1H3,(H,22,31)(H,23,32) |
| InChIKey | UUMLTINZBQPNGF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ioxilan (CHEBI:135884) is a amidobenzoic acid (CHEBI:48470) |
| Synonym | Source |
|---|---|
| ioxitol | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 1473 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:107793-72-6 | DrugCentral |