EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H36F3NO13 |
| Net Charge | 0 |
| Average Mass | 723.650 |
| Monoisotopic Mass | 723.21387 |
| SMILES | CCCCC(=O)OCC(=O)[C@]1(O)Cc2c(O)c3c(c(O)c2[C@@H](O[C@H]2C[C@H](NC(=O)C(F)(F)F)[C@H](O)[C@H](C)O2)C1)C(=O)c1c(OC)cccc1C3=O |
| InChI | InChI=1S/C34H36F3NO13/c1-4-5-9-21(40)49-13-20(39)33(47)11-16-24(19(12-33)51-22-10-17(27(41)14(2)50-22)38-32(46)34(35,36)37)31(45)26-25(29(16)43)28(42)15-7-6-8-18(48-3)23(15)30(26)44/h6-8,14,17,19,22,27,41,43,45,47H,4-5,9-13H2,1-3H3,(H,38,46)/t14-,17-,19-,22-,27+,33-/m0/s1 |
| InChIKey | ZOCKGBMQLCSHFP-KQRAQHLDSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| valrubicin (CHEBI:135876) has role antineoplastic agent (CHEBI:35610) |
| valrubicin (CHEBI:135876) is a anthracycline (CHEBI:48120) |
| valrubicin (CHEBI:135876) is a trifluoroacetamide (CHEBI:145723) |
| INNs | Source |
|---|---|
| valrubicina | WHO MedNet |
| valrubicine | WHO MedNet |
| Synonyms | Source |
|---|---|
| AD 32 | ChEMBL |
| AD-32 | DrugCentral |
| NSC-246131 | ChEMBL |
| N-Trifluoroacetyladriamycin 14-valerate | DrugCentral |
| N-Trifluoroacetyldoxorubicin 14-valerate | DrugCentral |
| Valrubicin | ChEMBL |
| Brand Name | Source |
|---|---|
| Valstar preservative free | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2805 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:56124-62-0 | DrugCentral |
| Citations |
|---|