EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H41N5O9 |
| Net Charge | 0 |
| Average Mass | 711.772 |
| Monoisotopic Mass | 711.29043 |
| SMILES | C=Cc1c(C)c2cc3nc(c(CC(=O)N[C@@H](CC(=O)O)C(=O)O)c4nc(cc5nc(cc1n2)C(C)=C5CC)c(C)c4C(=O)O)[C@@H](CCC(=O)O)[C@@H]3C |
| InChI | InChI=1S/C38H41N5O9/c1-7-20-16(3)24-12-26-18(5)22(9-10-32(45)46)35(42-26)23(11-31(44)41-30(37(49)50)15-33(47)48)36-34(38(51)52)19(6)27(43-36)14-29-21(8-2)17(4)25(40-29)13-28(20)39-24/h7,12-14,18,22,30,39,43H,1,8-11,15H2,2-6H3,(H,41,44)(H,45,46)(H,47,48)(H,49,50)(H,51,52)/b24-12-,25-13-,26-12-,27-14-,28-13-,29-14-,35-23-,36-23-/t18-,22-,30-/m0/s1 |
| InChIKey | VSEIDZLLWQQJGK-WSUYNKMOSA-N |
| Roles Classification |
|---|
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| talaporfin (CHEBI:135875) is a chlorins (CHEBI:33910) |
| Synonyms | Source |
|---|---|
| laserphyrin | DrugCentral |
| ME2906 | DrugCentral |
| N-Aspartyl chlorin e6 | DrugCentral |
| NPe6 | DrugCentral |
| talaporfin sodium | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 2555 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:110230-98-3 | DrugCentral |