EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H48NO10S.Na |
| Net Charge | 0 |
| Average Mass | 673.801 |
| Monoisotopic Mass | 673.28966 |
| SMILES | [H][C@@]12CC[C@](O)(C(=O)COC(=O)CCCCCCC(=O)N(C)CCS(=O)(=O)[O-])[C@@]1(C)C[C@H](O)[C@@]1([H])[C@@]2([H])C[C@H](C)C2=CC(=O)C=C[C@@]21C.[Na+] |
| InChI | InChI=1S/C33H49NO10S.Na/c1-21-17-23-24-12-14-33(40,32(24,3)19-26(36)30(23)31(2)13-11-22(35)18-25(21)31)27(37)20-44-29(39)10-8-6-5-7-9-28(38)34(4)15-16-45(41,42)43;/h11,13,18,21,23-24,26,30,36,40H,5-10,12,14-17,19-20H2,1-4H3,(H,41,42,43);/q;+1/p-1/t21-,23-,24-,26-,30+,31-,32-,33-;/m0./s1 |
| InChIKey | CDMLLMOLWUKNEK-AOHDELFNSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | glucocorticoid receptor agonist An agonist that selectively binds to and activates a glucocorticoid receptor. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. anti-asthmatic drug A drug used to treat asthma. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methylprednisolone suleptanate (CHEBI:135864) has part methylprednisolone 21-suleptanic acid ester(1−) (CHEBI:156481) |
| methylprednisolone suleptanate (CHEBI:135864) has role anti-asthmatic drug (CHEBI:49167) |
| methylprednisolone suleptanate (CHEBI:135864) has role anti-inflammatory agent (CHEBI:67079) |
| methylprednisolone suleptanate (CHEBI:135864) has role glucocorticoid receptor agonist (CHEBI:63562) |
| methylprednisolone suleptanate (CHEBI:135864) has role prodrug (CHEBI:50266) |
| methylprednisolone suleptanate (CHEBI:135864) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium 2-[{8-[(11β,17-dihydroxy-6α-methyl-3,20-dioxopregna-1,4-dien-21-yl)oxy]-8-oxooctanoyl}(methyl)amino]ethanesulfonate |
| INNs | Source |
|---|---|
| methylprednisolone suleptanate | WHO MedNet |
| methylprednisoloni suleptanas | WHO MedNet |
| suleptanate de méthylprednisolone | WHO MedNet |
| suleptanato de metilprednisolona | WHO MedNet |
| Synonyms | Source |
|---|---|
| methylprednisolone suleptanate sodium | DrugCentral |
| methylprednisolone suleptanate sodium salt | DrugCentral |
| PNU 67590A | ChemIDplus |
| PNU-67590A | ChEBI |
| sodium 2-[{8-[(11β,17-dihydroxy-6α-methyl-3,20-dioxopregna-1,4-dien-21-yl)oxy]-8-oxooctanoyl}(methyl)amino]ethane-1-sulfonate | IUPAC |
| U-67,590A | ChemIDplus |
| Brand Names | Source |
|---|---|
| Medrosol | ChemIDplus |
| Promedrol | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1772 | DrugCentral |
| D05002 | KEGG DRUG |
| Methylprednisolone_suleptanate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:90350-40-6 | ChemIDplus |
| Citations |
|---|