EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18I3NO3 |
| Net Charge | 0 |
| Average Mass | 641.025 |
| Monoisotopic Mass | 640.84209 |
| SMILES | CCCC(=O)Nc1c(I)cc(I)c(CC(CC)C(=O)O)c1I |
| InChI | InChI=1S/C15H18I3NO3/c1-3-5-12(20)19-14-11(17)7-10(16)9(13(14)18)6-8(4-2)15(21)22/h7-8H,3-6H2,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | YMOXVLQZFAUUKI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tyropanoate (CHEBI:135862) is a benzenes (CHEBI:22712) |
| tyropanoate (CHEBI:135862) is a monocarboxylic acid (CHEBI:25384) |
| Synonyms | Source |
|---|---|
| tyropanoate sodium | DrugCentral |
| tyropanoic acid | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 2785 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:27293-82-9 | DrugCentral |