EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H16I3NO3 |
| Net Charge | 0 |
| Average Mass | 639.009 |
| Monoisotopic Mass | 638.82644 |
| SMILES | CCCC(=O)Nc1c(I)cc(I)c(/C=C(\CC)C(=O)O)c1I |
| InChI | InChI=1S/C15H16I3NO3/c1-3-5-12(20)19-14-11(17)7-10(16)9(13(14)18)6-8(4-2)15(21)22/h6-7H,3-5H2,1-2H3,(H,19,20)(H,21,22)/b8-6+ |
| InChIKey | CWRBDUIQDIHWJZ-SOFGYWHQSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bunamiodyl (CHEBI:135861) is a cinnamic acids (CHEBI:23252) |
| INN | Source |
|---|---|
| bunamiodilo | WHO MedNet |
| Synonyms | Source |
|---|---|
| Bunamiodyl | ChEMBL |
| buniodyl | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 3048 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:1233-53-0 | DrugCentral |