EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:135856 - cefbuperazone
| Formula | C22H29N9O9S2 |
| Net Charge | 0 |
| Average Mass | 627.662 |
| Monoisotopic Mass | 627.15297 |
| SMILES | [H][C@](NC(=O)N1CCN(CC)C(=O)C1=O)(C(=O)N[C@]1(OC)C(=O)N2C(C(=O)O)=C(CSc3nnnn3C)CS[C@@]21[H])[C@H](C)O |
| InChI | InChI=1S/C22H29N9O9S2/c1-5-29-6-7-30(16(35)15(29)34)20(39)23-12(10(2)32)14(33)24-22(40-4)18(38)31-13(17(36)37)11(8-41-19(22)31)9-42-21-25-26-27-28(21)3/h10,12,19,32H,5-9H2,1-4H3,(H,23,39)(H,24,33)(H,36,37)/t10-,12+,19+,22-/m0/s1 |
| InChIKey | SMSRCGPDNDCXFR-CYWZMYCQSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefbuperazone (CHEBI:135856) is a cephalosporin (CHEBI:23066) |
| cefbuperazone (CHEBI:135856) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (7S)-7-({N-[(4-ethyl-2,3-dioxopiperazin-1-yl)carbonyl]-D-threonyl}amino)-7-methoxy-3-{[(1-methyl-1H-tetrazol-5-yl)sulfanyl]methyl}-3,4-didehydrocepham-4-carboxylic acid |
| INNs | Source |
|---|---|
| cefbuperazone | ChemIDplus |
| cefbuperazona | ChEBI |
| cerbuperazone | ChemIDplus |
| cefbuperazonum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (6R,7S)-7-({N-[(4-ethyl-2,3-dioxopiperazin-1-yl)carbonyl]-D-threonyl}amino)-7-methoxy-3-{[(1-methyl-1H-tetrazol-5-yl)sulfanyl]methyl}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid | IUPAC |
| CBPZ | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 3072 | DrugCentral |
| Cefbuperazone | Wikipedia |
| D03423 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:76610-84-9 | DrugCentral |
| CAS:76610-84-9 | ChemIDplus |
| Citations |
|---|