EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H38N8O8 |
| Net Charge | 0 |
| Average Mass | 626.671 |
| Monoisotopic Mass | 626.28126 |
| SMILES | [H][C@]12C[C@@]3([H])[C@H](N(C)C)C(O)=C(C(=O)NCN4CCN(C(=N)NC(=N)N)CC4)C(=O)[C@@]3(O)C(O)=C1C(=O)c1c(O)cccc1[C@@]2(C)O |
| InChI | InChI=1S/C29H38N8O8/c1-28(44)13-5-4-6-16(38)17(13)21(39)18-14(28)11-15-20(35(2)3)22(40)19(24(42)29(15,45)23(18)41)25(43)33-12-36-7-9-37(10-8-36)27(32)34-26(30)31/h4-6,14-15,20,38,40-41,44-45H,7-12H2,1-3H3,(H,33,43)(H5,30,31,32,34)/t14-,15-,20-,28+,29-/m0/s1 |
| InChIKey | DIRJDIBCAHCCFL-AQFAATAFSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| guamecycline (CHEBI:135854) is a tetracyclines (CHEBI:26895) |
| Synonyms | Source |
|---|---|
| tetrabiguanide | DrugCentral |
| Xanthomycin A | DrugCentral |
| xantomicina | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 3273 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:16545-11-2 | DrugCentral |