EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H48N2O10 |
| Net Charge | 0 |
| Average Mass | 620.740 |
| Monoisotopic Mass | 620.33090 |
| SMILES | CC[C@@H](COC(=O)c1cc(OC)c(OC)c(OC)c1)N(C)CCN(C)[C@@H](CC)COC(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C32H48N2O10/c1-11-23(19-43-31(35)21-15-25(37-5)29(41-9)26(16-21)38-6)33(3)13-14-34(4)24(12-2)20-44-32(36)22-17-27(39-7)30(42-10)28(18-22)40-8/h15-18,23-24H,11-14,19-20H2,1-10H3/t23-,24-/m0/s1 |
| InChIKey | ZKSIPEYIAHUPNM-ZEQRLZLVSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| butobendine (CHEBI:135851) is a trihydroxybenzoic acid (CHEBI:27115) |
| INNs | Source |
|---|---|
| butobendina | WHO MedNet |
| butobendine | WHO MedNet |
| Synonym | Source |
|---|---|
| butobendin | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 3695 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:55769-65-8 | DrugCentral |