EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H40N2O9 |
| Net Charge | 0 |
| Average Mass | 608.688 |
| Monoisotopic Mass | 608.27338 |
| SMILES | [H][C@]12C[C@@H](OC(=O)c3cc(OC)c(OC)c(OC)c3)[C@H](OC)[C@@H](C(=O)OC)[C@@]1([H])C[C@]1([H])c3nc4ccc(OC)cc4c3CCN1C2 |
| InChI | InChI=1S/C33H40N2O9/c1-38-19-7-8-23-22(14-19)20-9-10-35-16-18-13-27(44-32(36)17-11-25(39-2)30(41-4)26(12-17)40-3)31(42-5)28(33(37)43-6)21(18)15-24(35)29(20)34-23/h7-8,11-12,14,18,21,24,27-28,31,34H,9-10,13,15-16H2,1-6H3/t18-,21+,24-,27-,28+,31+/m1/s1 |
| InChIKey | ULBNWNUHGJLQHO-VKMIBBQISA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methoserpidine (CHEBI:135848) is a yohimban alkaloid (CHEBI:27358) |
| Synonyms | Source |
|---|---|
| 10-Methoxydeserpidine | DrugCentral |
| decaserpin | DrugCentral |
| decaserpine | DrugCentral |
| decaserpyl | DrugCentral |
| decoserpyl | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 1750 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:865-04-3 | DrugCentral |