EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H24N4O10 |
| Net Charge | 0 |
| Average Mass | 600.540 |
| Monoisotopic Mass | 600.14924 |
| SMILES | O=C(OC[C@H]1O[C@](O)(COC(=O)c2cccnc2)[C@@H](OC(=O)c2cccnc2)[C@@H]1OC(=O)c1cccnc1)c1cccnc1 |
| InChI | InChI=1S/C30H24N4O10/c35-26(19-5-1-9-31-13-19)40-17-23-24(42-28(37)21-7-3-11-33-15-21)25(43-29(38)22-8-4-12-34-16-22)30(39,44-23)18-41-27(36)20-6-2-10-32-14-20/h1-16,23-25,39H,17-18H2/t23-,24-,25+,30-/m1/s1 |
| InChIKey | FUWFSXZKBMCSKF-ZASNTINBSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nicofuranose (CHEBI:135846) has functional parent tetracarboxylic acid (CHEBI:35742) |
| nicofuranose (CHEBI:135846) has role cardiovascular drug (CHEBI:35554) |
| nicofuranose (CHEBI:135846) is a organooxygen compound (CHEBI:36963) |
| INN | Source |
|---|---|
| nicofuranosa | WHO MedNet |
| Synonyms | Source |
|---|---|
| bradilan | DrugCentral |
| ES 304 | ChEMBL |
| ES-304 | ChEMBL |
| L-Nicofuranosum | DrugCentral |
| Nicofuranose | ChEMBL |
| nicofurazone | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 1916 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:15351-13-0 | DrugCentral |
| Citations |
|---|