EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H44N2O10 |
| Net Charge | 0 |
| Average Mass | 592.686 |
| Monoisotopic Mass | 592.29960 |
| SMILES | COc1cc(C(=O)OCCCN(C)CCN(C)CCCOC(=O)c2cc(OC)c(OC)c(OC)c2)cc(OC)c1OC |
| InChI | InChI=1S/C30H44N2O10/c1-31(11-9-15-41-29(33)21-17-23(35-3)27(39-7)24(18-21)36-4)13-14-32(2)12-10-16-42-30(34)22-19-25(37-5)28(40-8)26(20-22)38-6/h17-20H,9-16H2,1-8H3 |
| InChIKey | KRQAMFQCSAJCRH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hexobendine (CHEBI:135843) is a trihydroxybenzoic acid (CHEBI:27115) |
| Synonyms | Source |
|---|---|
| ditrimin | DrugCentral |
| ditrimine | DrugCentral |
| ditrymine | DrugCentral |
| hexabendin | DrugCentral |
| hexabendine | DrugCentral |
| hexobendin | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 1370 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:54-03-5 | DrugCentral |