EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H38ClFO8 |
| Net Charge | 0 |
| Average Mass | 569.066 |
| Monoisotopic Mass | 568.22392 |
| SMILES | [H][C@@]12C[C@@]3([H])OC(C)(C)O[C@@]3(C(=O)COC(C)=O)[C@@]1(C)C[C@H](O)[C@@]1(F)[C@@]2([H])CC(C=O)=C2C=C(OCCCl)CC[C@@]21C |
| InChI | InChI=1S/C29H38ClFO8/c1-16(33)37-15-23(35)29-24(38-25(2,3)39-29)12-20-21-10-17(14-32)19-11-18(36-9-8-30)6-7-26(19,4)28(21,31)22(34)13-27(20,29)5/h11,14,20-22,24,34H,6-10,12-13,15H2,1-5H3/t20-,21-,22-,24+,26-,27-,28-,29+/m0/s1 |
| InChIKey | QNXUUBBKHBYRFW-QWAPGEGQSA-N |
| Roles Classification |
|---|
| Application: | ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| formocortal (CHEBI:135834) has parent hydride pregnane (CHEBI:8386) |
| formocortal (CHEBI:135834) has role ophthalmology drug (CHEBI:66981) |
| formocortal (CHEBI:135834) is a steroid (CHEBI:35341) |
| Synonyms | Source |
|---|---|
| cutisterol | DrugCentral |
| deflamene | DrugCentral |
| fluoformylon | DrugCentral |
| fluoroformylon | DrugCentral |
| fluoroformylone | DrugCentral |
| Formocortal | ChEMBL |
| Brand Name | Source |
|---|---|
| Fluderma | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 3245 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:2825-60-7 | DrugCentral |