EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H28N4O11S |
| Net Charge | 0 |
| Average Mass | 568.561 |
| Monoisotopic Mass | 568.14753 |
| SMILES | [H][C@]12SCC(COC(N)=O)=C(C(=O)OC(C)OC(=O)C(C)(C)OC)N1C(=O)[C@@]2([H])NC(=O)/C(=N\OC)c1ccco1 |
| InChI | InChI=1S/C23H28N4O11S/c1-11(38-21(31)23(2,3)33-4)37-20(30)16-12(9-36-22(24)32)10-39-19-15(18(29)27(16)19)25-17(28)14(26-34-5)13-7-6-8-35-13/h6-8,11,15,19H,9-10H2,1-5H3,(H2,24,32)(H,25,28)/b26-14-/t11?,15-,19-/m1/s1 |
| InChIKey | MGYPWVCKENORQX-KMMUMHRISA-N |
| Roles Classification |
|---|
| Biological Roles: | drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefuroxime pivoxetil (CHEBI:135833) is a carbamate ester (CHEBI:23003) |
| cefuroxime pivoxetil (CHEBI:135833) is a cephalosporin (CHEBI:23066) |
| Manual Xrefs | Databases |
|---|---|
| 567 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:100680-33-9 | DrugCentral |