EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H9I3O3 |
| Net Charge | 0 |
| Average Mass | 557.891 |
| Monoisotopic Mass | 557.76859 |
| SMILES | CCC(Oc1c(I)cc(I)cc1I)C(=O)O |
| InChI | InChI=1S/C10H9I3O3/c1-2-8(10(14)15)16-9-6(12)3-5(11)4-7(9)13/h3-4,8H,2H2,1H3,(H,14,15) |
| InChIKey | VYAGDYWTCWDKIS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phenobutiodil (CHEBI:135828) is a monocarboxylic acid (CHEBI:25384) |
| Synonyms | Source |
|---|---|
| baygnostil | DrugCentral |
| biliodyl | DrugCentral |
| cholognost | DrugCentral |
| felotrast | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 3812 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:554-24-5 | DrugCentral |