EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H21N7O7S3 |
| Net Charge | 0 |
| Average Mass | 519.587 |
| Monoisotopic Mass | 519.06646 |
| SMILES | [H][C@]12SCC(CSc3nnnn3C)=C(C(=O)O)N1C(=O)[C@]2(NC(=O)CSC[C@@H](N)C(=O)O)OC |
| InChI | InChI=1S/C16H21N7O7S3/c1-22-15(19-20-21-22)33-4-7-3-32-14-16(30-2,13(29)23(14)10(7)12(27)28)18-9(24)6-31-5-8(17)11(25)26/h8,14H,3-6,17H2,1-2H3,(H,18,24)(H,25,26)(H,27,28)/t8-,14-,16+/m1/s1 |
| InChIKey | JSDXOWVAHXDYCU-VXSYNFHWSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefminox (CHEBI:135817) has role antibacterial agent (CHEBI:33282) |
| cefminox (CHEBI:135817) is a cephamycin (CHEBI:55429) |
| cefminox (CHEBI:135817) is a tetrazoles (CHEBI:35689) |
| cefminox (CHEBI:135817) is conjugate acid of cefminox(1−) (CHEBI:157675) |
| Incoming Relation(s) |
| cefminox(1−) (CHEBI:157675) is conjugate base of cefminox (CHEBI:135817) |
| IUPAC Name |
|---|
| (7S)-7-(2-{[(2S)-2-amino-2-carboxyethyl]sulfanyl}acetamido)-7-methoxy-3-{[(1-methyl-1H-tetrazol-5-yl)sulfanyl]methyl}-3,4-didehydrocepham-4-carboxylic acid |
| INNs | Source |
|---|---|
| cefminox | WHO MedNet |
| cefminox | WHO MedNet |
| cefminox | ChemIDplus |
| cefminoxum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (6R,7S)-7-(2-{[(2S)-2-amino-2-carboxyethyl]sulfanyl}acetamido)-7-methoxy-3-{[(1-methyl-1H-tetrazol-5-yl)sulfanyl]methyl}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid | IUPAC |
| MT-141 FREE ACID | ChEMBL |
| Citations |
|---|