EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H12I2O3 |
| Net Charge | 0 |
| Average Mass | 518.088 |
| Monoisotopic Mass | 517.88759 |
| SMILES | CCc1oc2ccccc2c1C(=O)c1cc(I)c(O)c(I)c1 |
| InChI | InChI=1S/C17H12I2O3/c1-2-13-15(10-5-3-4-6-14(10)22-13)16(20)9-7-11(18)17(21)12(19)8-9/h3-8,21H,2H2,1H3 |
| InChIKey | CZCHIEJNWPNBDE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benziodarone (CHEBI:135814) has role cardiovascular drug (CHEBI:35554) |
| benziodarone (CHEBI:135814) is a aromatic ketone (CHEBI:76224) |
| INN | Source |
|---|---|
| benciodarona | WHO MedNet |
| Synonyms | Source |
|---|---|
| Amplivix | ChEMBL |
| Benziodarone | KEGG COMPOUND |
| cardivix | DrugCentral |
| dilafurane | DrugCentral |
| L 2329 | ChEMBL |
| L-2329 | ChEMBL |
| Citations |
|---|