EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18F2N6O7S2 |
| Net Charge | 0 |
| Average Mass | 496.474 |
| Monoisotopic Mass | 496.06465 |
| SMILES | [H][C@]12OCC(CSc3nnnn3CCO)=C(C(=O)O)N1C(=O)[C@]2(NC(=O)CSC(F)F)OC |
| InChI | InChI=1S/C15H18F2N6O7S2/c1-29-15(18-8(25)6-31-13(16)17)11(28)23-9(10(26)27)7(4-30-12(15)23)5-32-14-19-20-21-22(14)2-3-24/h12-13,24H,2-6H2,1H3,(H,18,25)(H,26,27)/t12-,15+/m1/s1 |
| InChIKey | UHRBTBZOWWGKMK-DOMZBBRYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flomoxef (CHEBI:135813) has role antibacterial drug (CHEBI:36047) |
| flomoxef (CHEBI:135813) is a N-acyl-amino acid (CHEBI:51569) |
| flomoxef (CHEBI:135813) is a organonitrogen heterocyclic antibiotic (CHEBI:25558) |
| flomoxef (CHEBI:135813) is a oxacephem (CHEBI:55506) |
| IUPAC Name |
|---|
| (6R,7R)-7-{2-[(difluoromethyl)sulfanyl]acetamido}-3-({[1-(2-hydroxyethyl)-1H-tetrazol-5-yl]sulfanyl}methyl)-7-methoxy-8-oxo-5-oxa-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| INNs | Source |
|---|---|
| flomoxef | ChemIDplus |
| flomoxef | WHO MedNet |
| flomoxef | WHO MedNet |
| flomoxefum | WHO MedNet |
| Synonym | Source |
|---|---|
| FMOX | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6993219 | Reaxys |
| CAS:99665-00-6 | DrugCentral |
| CAS:99665-00-6 | ChemIDplus |
| Citations |
|---|