EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H25N5O7S2 |
| Net Charge | 0 |
| Average Mass | 511.582 |
| Monoisotopic Mass | 511.11954 |
| SMILES | [H][C@]12SCC(C)=C(C(=O)OCOC(=O)C(C)(C)C)N1C(=O)[C@H]2NC(=O)/C(=N\OC)c1csc(N)n1 |
| InChI | InChI=1S/C20H25N5O7S2/c1-9-6-33-16-12(23-14(26)11(24-30-5)10-7-34-19(21)22-10)15(27)25(16)13(9)17(28)31-8-32-18(29)20(2,3)4/h7,12,16H,6,8H2,1-5H3,(H2,21,22)(H,23,26)/b24-11-/t12-,16-/m1/s1 |
| InChIKey | DASYMCLQENWCJG-XUKDPADISA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefetamet pivoxil (CHEBI:135812) is a 1,3-thiazoles (CHEBI:38418) |
| cefetamet pivoxil (CHEBI:135812) is a cephams (CHEBI:35995) |
| cefetamet pivoxil (CHEBI:135812) is a oxime O-ether (CHEBI:36816) |
| cefetamet pivoxil (CHEBI:135812) is a pivaloyloxymethyl ester (CHEBI:136685) |
| Synonyms | Source |
|---|---|
| cefetamet pivoxil HCl | DrugCentral |
| cefetamet pivoxil hydrochloride | DrugCentral |
| ceftamet pivoxil | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 536 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:65243-33-6 | DrugCentral |