EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H39N3O8 |
| Net Charge | 0 |
| Average Mass | 509.600 |
| Monoisotopic Mass | 509.27372 |
| SMILES | CC1(C)OC[C@@H](COC(=O)CCc2ccc(OC[C@@H](O)CNCCNC(=O)N3CCOCC3)cc2)O1 |
| InChI | InChI=1S/C25H39N3O8/c1-25(2)35-18-22(36-25)17-34-23(30)8-5-19-3-6-21(7-4-19)33-16-20(29)15-26-9-10-27-24(31)28-11-13-32-14-12-28/h3-4,6-7,20,22,26,29H,5,8-18H2,1-2H3,(H,27,31)/t20-,22+/m0/s1 |
| InChIKey | WMDSZGFJQKSLLH-RBBKRZOGSA-N |
| Roles Classification |
|---|
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| landiolol (CHEBI:135809) has role anti-arrhythmia drug (CHEBI:38070) |
| landiolol (CHEBI:135809) has role cardiovascular drug (CHEBI:35554) |
| landiolol (CHEBI:135809) is a morpholines (CHEBI:38785) |
| Synonyms | Source |
|---|---|
| AOP-200704 | ChEMBL |
| AOP200704 | ChEMBL |
| Landiolol | ChEMBL |
| landiolol HCl | DrugCentral |
| landiolol hydrochloride | DrugCentral |
| LDLL-600 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1545 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:133242-30-5 | DrugCentral |