EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H31N3O6 |
| Net Charge | 0 |
| Average Mass | 505.571 |
| Monoisotopic Mass | 505.22129 |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)O[C@@H]2CCCN(Cc3ccccc3)C2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H31N3O6/c1-18-24(27(32)36-3)26(21-11-7-12-22(15-21)31(34)35)25(19(2)29-18)28(33)37-23-13-8-14-30(17-23)16-20-9-5-4-6-10-20/h4-7,9-12,15,23,26,29H,8,13-14,16-17H2,1-3H3/t23-,26?/m1/s1 |
| InChIKey | QZVNQOLPLYWLHQ-GEPVFLLWSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benidipine (CHEBI:135806) has role cardiovascular drug (CHEBI:35554) |
| benidipine (CHEBI:135806) is a piperidines (CHEBI:26151) |
| INN | Source |
|---|---|
| benidipino | WHO MedNet |
| Synonyms | Source |
|---|---|
| Benidipine | ChEMBL |
| benidipine HCl | DrugCentral |
| benidipine hydrochloride | DrugCentral |
| coniel | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 3880 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:105979-17-7 | DrugCentral |
| Citations |
|---|