EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28Cl4N2O4 |
| Net Charge | 0 |
| Average Mass | 502.266 |
| Monoisotopic Mass | 500.08032 |
| SMILES | CCOCCN(Cc1ccc(CN(CCOCC)C(=O)C(Cl)Cl)cc1)C(=O)C(Cl)Cl |
| InChI | InChI=1S/C20H28Cl4N2O4/c1-3-29-11-9-25(19(27)17(21)22)13-15-5-7-16(8-6-15)14-26(10-12-30-4-2)20(28)18(23)24/h5-8,17-18H,3-4,9-14H2,1-2H3 |
| InChIKey | MSJLJWCAEPENBL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antiamoebic agent An antiparasitic agent which is effective against amoeba, a genus of single-celled amoeboids in the family Amoebidae. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| teclozan (CHEBI:135803) has role antiamoebic agent (CHEBI:171664) |
| teclozan (CHEBI:135803) is a benzenes (CHEBI:22712) |
| teclozan (CHEBI:135803) is a organic molecular entity (CHEBI:50860) |
| Synonyms | Source |
|---|---|
| falmonox | DrugCentral |
| NSC-107433 | ChEMBL |
| teclosan | DrugCentral |
| teclosine | DrugCentral |
| Teclozan | ChEMBL |
| teclozine | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 2576 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:5560-78-1 | DrugCentral |